C35H40F5N7O4 — CID 129073250
(2,3,4,5,6-pentafluorophenyl) 5-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]-5-oxopentanoate (PubChem CID 129073250) has the molecular formula C35H40F5N7O4 and a molecular weight of 717.74 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]-5-oxopentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 129073250 |
| Molecular Formula | C35H40F5N7O4 |
| Molecular Weight | 717.74 g/mol |
| Exact Mass | 717.31 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methoxyphenyl]methyl]piperazin-1-yl]-5-oxopentanoate |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCN(C(=O)CCCC(=O)Oc5c(F)c(F)c(F)c(F)c5F)CC4)cc3OC)c12 |
| InChI | InChI=1S/C35H40F5N7O4/c1-3-4-5-12-42-34-32-23(43-35(41)44-34)11-13-47(32)20-22-10-9-21(18-24(22)50-2)19-45-14-16-46(17-15-45)25(48)7-6-8-26(49)51-33-30(39)28(37)27(36)29(38)31(33)40/h9-11,13,18H,3-8,12,14-17,19-20H2,1-2H3,(H3,41,42,43,44) |
| InChIKey | AUALRVLTWCKTAC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.74 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|