C17H24N4O6 — CID 129073412
2-[(1Z)-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1,11,13-trien-6-yl]acetic acid (PubChem CID 129073412) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[(1Z)-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1,11,13-trien-6-yl]acetic acid.
| Compound Name | 2-[(1Z)-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1,11,13-trien-6-yl]acetic acid |
|---|---|
| PubChem CID | 129073412 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(1Z)-3,9-bis(carboxymethyl)-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1,11,13-trien-6-yl]acetic acid |
| SMILES | O=C(O)CN1/C=C2\C=CC=C(CN(CC(=O)O)CCN(CC(=O)O)CC1)N2 |
| InChI | InChI=1S/C17H24N4O6/c22-15(23)10-19-4-6-20(11-16(24)25)8-13-2-1-3-14(18-13)9-21(7-5-19)12-17(26)27/h1-3,8,18H,4-7,9-12H2,(H,22,23)(H,24,25)(H,26,27)/b13-8+ |
| InChIKey | YVPFFQHGHBPFKY-MDWZMJQESA-N |
| XLogP | -0.96 |
| TPSA | 133.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |