About (diaminomethylideneamino) thiocyanate;ethanol
(diaminomethylideneamino) thiocyanate;ethanol (PubChem CID 129073471) has the molecular formula C4H10N4OS
and a molecular weight of 162.22 g/mol. Its IUPAC name is (diaminomethylideneamino) thiocyanate;ethanol.
Molecular Properties
| Compound Name | (diaminomethylideneamino) thiocyanate;ethanol |
| PubChem CID | 129073471 |
| Molecular Formula | C4H10N4OS |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (diaminomethylideneamino) thiocyanate;ethanol |
| SMILES | CCO.N#CSN=C(N)N |
| InChI | InChI=1S/C2H4N4S.C2H6O/c3-1-7-6-2(4)5;1-2-3/h(H4,4,5,6);3H,2H2,1H3 |
| InChIKey | TUHDMDWCNJLCHH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (diaminomethylideneamino) thiocyanate;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diaminomethylideneamino) thiocyanate;ethanol?
The IUPAC name of (diaminomethylideneamino) thiocyanate;ethanol (CID 129073471) is (diaminomethylideneamino) thiocyanate;ethanol.
What is the SMILES notation for (diaminomethylideneamino) thiocyanate;ethanol?
The canonical SMILES for (diaminomethylideneamino) thiocyanate;ethanol is CCO.N#CSN=C(N)N.
What is the InChIKey of (diaminomethylideneamino) thiocyanate;ethanol?
The InChIKey is TUHDMDWCNJLCHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4S.C2H6O/c3-1-7-6-2(4)5;1-2-3/h(H4,4,5,6);3H,2H2,1H3.
What are the key properties of (diaminomethylideneamino) thiocyanate;ethanol?
(diaminomethylideneamino) thiocyanate;ethanol has a molecular weight of 162.22 g/mol, XLogP of -0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (diaminomethylideneamino) thiocyanate;ethanol is sourced from PubChem (CID 129073471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).