C9H10FN5 — CID 129073645
(1S)-1-[5-(4-fluoropyrazol-1-yl)pyrazin-2-yl]ethanamine (PubChem CID 129073645) has the molecular formula C9H10FN5 and a molecular weight of 207.21 g/mol. Its IUPAC name is (1S)-1-[5-(4-fluoropyrazol-1-yl)pyrazin-2-yl]ethanamine.
| Compound Name | (1S)-1-[5-(4-fluoropyrazol-1-yl)pyrazin-2-yl]ethanamine |
|---|---|
| PubChem CID | 129073645 |
| Molecular Formula | C9H10FN5 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (1S)-1-[5-(4-fluoropyrazol-1-yl)pyrazin-2-yl]ethanamine |
| SMILES | C[C@H](N)c1cnc(-n2cc(F)cn2)cn1 |
| InChI | InChI=1S/C9H10FN5/c1-6(11)8-3-13-9(4-12-8)15-5-7(10)2-14-15/h2-6H,11H2,1H3/t6-/m0/s1 |
| InChIKey | XFJRDDYDWNTDCW-LURJTMIESA-N |
| XLogP | 0.82 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |