About N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine
N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine (PubChem CID 129074589) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine |
| PubChem CID | 129074589 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine |
| SMILES | C=CC[C@@H](/C=C\N=C)CC |
| InChI | InChI=1S/C9H15N/c1-4-6-9(5-2)7-8-10-3/h4,7-9H,1,3,5-6H2,2H3/b8-7-/t9-/m0/s1 |
| InChIKey | JWNSRQBXWNMQPX-FUOZMLNRSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine?
The IUPAC name of N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine (CID 129074589) is N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine.
What is the SMILES notation for N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine?
The canonical SMILES for N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine is C=CC[C@@H](/C=C\N=C)CC.
What is the InChIKey of N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine?
The InChIKey is JWNSRQBXWNMQPX-FUOZMLNRSA-N. The full InChI is InChI=1S/C9H15N/c1-4-6-9(5-2)7-8-10-3/h4,7-9H,1,3,5-6H2,2H3/b8-7-/t9-/m0/s1.
What are the key properties of N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine?
N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine has a molecular weight of 137.23 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z,3S)-3-ethylhexa-1,5-dienyl]methanimine is sourced from PubChem (CID 129074589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).