C25H40O8 — CID 12907473
(11E,13E)-7-(1,3-dioxolan-2-ylmethyl)-16-ethyl-4,6-dihydroxy-15-(hydroxymethyl)-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 12907473) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is (11E,13E)-7-(1,3-dioxolan-2-ylmethyl)-16-ethyl-4,6-dihydroxy-15-(hydroxymethyl)-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | (11E,13E)-7-(1,3-dioxolan-2-ylmethyl)-16-ethyl-4,6-dihydroxy-15-(hydroxymethyl)-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 12907473 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (11E,13E)-7-(1,3-dioxolan-2-ylmethyl)-16-ethyl-4,6-dihydroxy-15-(hydroxymethyl)-5,9,13-trimethyl-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CCC1OC(=O)CC(O)C(C)C(O)C(CC2OCCO2)CC(C)C(=O)/C=C/C(C)=C/C1CO |
| InChI | InChI=1S/C25H40O8/c1-5-22-19(14-26)10-15(2)6-7-20(27)16(3)11-18(12-24-31-8-9-32-24)25(30)17(4)21(28)13-23(29)33-22/h6-7,10,16-19,21-22,24-26,28,30H,5,8-9,11-14H2,1-4H3/b7-6+,15-10+ |
| InChIKey | MKCYLESCPYAFPR-HCRXKHKBSA-N |
| XLogP | 2.16 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |