C27H50N2 — CID 129074760
(8aS)-2-butyl-N-cyclohexyl-N-heptyl-3-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-amine (PubChem CID 129074760) has the molecular formula C27H50N2 and a molecular weight of 402.71 g/mol. Its IUPAC name is (8aS)-2-butyl-N-cyclohexyl-N-heptyl-3-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-amine.
| Compound Name | (8aS)-2-butyl-N-cyclohexyl-N-heptyl-3-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-amine |
|---|---|
| PubChem CID | 129074760 |
| Molecular Formula | C27H50N2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.40 |
| IUPAC Name | (8aS)-2-butyl-N-cyclohexyl-N-heptyl-3-methyl-3,4,4a,5,6,7,8,8a-octahydroquinolin-4-amine |
| SMILES | CCCCCCCN(C1CCCCC1)C1C(C)C(CCCC)=N[C@H]2CCCCC12 |
| InChI | InChI=1S/C27H50N2/c1-4-6-8-9-15-21-29(23-16-11-10-12-17-23)27-22(3)25(19-7-5-2)28-26-20-14-13-18-24(26)27/h22-24,26-27H,4-21H2,1-3H3/t22?,24?,26-,27?/m0/s1 |
| InChIKey | FPINSQWNJPUOQH-HJEMJIKGSA-N |
| XLogP | 7.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|