About N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine
N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine (PubChem CID 129074855) has the molecular formula C15H26N4
and a molecular weight of 262.40 g/mol. Its IUPAC name is N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine.
Molecular Properties
| Compound Name | N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine |
| PubChem CID | 129074855 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine |
| SMILES | CC/N=C(\C=N\C1CC=CC[C@H]1C)N1CCNCC1 |
| InChI | InChI=1S/C15H26N4/c1-3-17-15(19-10-8-16-9-11-19)12-18-14-7-5-4-6-13(14)2/h4-5,12-14,16H,3,6-11H2,1-2H3/b17-15+,18-12+/t13-,14?/m1/s1 |
| InChIKey | KXUCPEQRWGQKFE-XPQGWHCDSA-N |
| XLogP | 1.74 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine?
The IUPAC name of N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine (CID 129074855) is N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine.
What is the SMILES notation for N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine?
The canonical SMILES for N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine is CC/N=C(\C=N\C1CC=CC[C@H]1C)N1CCNCC1.
What is the InChIKey of N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine?
The InChIKey is KXUCPEQRWGQKFE-XPQGWHCDSA-N. The full InChI is InChI=1S/C15H26N4/c1-3-17-15(19-10-8-16-9-11-19)12-18-14-7-5-4-6-13(14)2/h4-5,12-14,16H,3,6-11H2,1-2H3/b17-15+,18-12+/t13-,14?/m1/s1.
What are the key properties of N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine?
N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine has a molecular weight of 262.40 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-[(6R)-6-methylcyclohex-3-en-1-yl]-1-piperazin-1-ylethane-1,2-diimine is sourced from PubChem (CID 129074855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).