C22H21ClN6O2S — CID 129075302
(3R,6S)-4-N'-(3-chloro-1,7-naphthyridin-8-yl)-6-cyclopropyl-6-methyl-1,1-dioxospiro[2H-1,4-thiazine-3,7'-3-azabicyclo[4.2.0]octa-1,3,5-triene]-4',5-diamine (PubChem CID 129075302) has the molecular formula C22H21ClN6O2S and a molecular weight of 468.97 g/mol. Its IUPAC name is (3R,6S)-4-N'-(3-chloro-1,7-naphthyridin-8-yl)-6-cyclopropyl-6-methyl-1,1-dioxospiro[2H-1,4-thiazine-3,7'-3-azabicyclo[4.2.0]octa-1,3,5-triene]-4',5-diamine.
| Compound Name | (3R,6S)-4-N'-(3-chloro-1,7-naphthyridin-8-yl)-6-cyclopropyl-6-methyl-1,1-dioxospiro[2H-1,4-thiazine-3,7'-3-azabicyclo[4.2.0]octa-1,3,5-triene]-4',5-diamine |
|---|---|
| PubChem CID | 129075302 |
| Molecular Formula | C22H21ClN6O2S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (3R,6S)-4-N'-(3-chloro-1,7-naphthyridin-8-yl)-6-cyclopropyl-6-methyl-1,1-dioxospiro[2H-1,4-thiazine-3,7'-3-azabicyclo[4.2.0]octa-1,3,5-triene]-4',5-diamine |
| SMILES | C[C@]1(C2CC2)C(N)=N[C@@]2(Cc3cnc(Nc4nccc5cc(Cl)cnc45)cc32)CS1(=O)=O |
| InChI | InChI=1S/C22H21ClN6O2S/c1-21(14-2-3-14)20(24)29-22(11-32(21,30)31)8-13-9-26-17(7-16(13)22)28-19-18-12(4-5-25-19)6-15(23)10-27-18/h4-7,9-10,14H,2-3,8,11H2,1H3,(H2,24,29)(H,25,26,28)/t21-,22-/m0/s1 |
| InChIKey | KDCFWSDQHKSTSN-VXKWHMMOSA-N |
| XLogP | 3.13 |
| TPSA | 123.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |