About (4-fluoro-2-methylphenyl) propanedithioate
(4-fluoro-2-methylphenyl) propanedithioate (PubChem CID 129075399) has the molecular formula C10H11FS2
and a molecular weight of 214.33 g/mol. Its IUPAC name is (4-fluoro-2-methylphenyl) propanedithioate.
Molecular Properties
| Compound Name | (4-fluoro-2-methylphenyl) propanedithioate |
| PubChem CID | 129075399 |
| Molecular Formula | C10H11FS2 |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | (4-fluoro-2-methylphenyl) propanedithioate |
| SMILES | CCC(=S)Sc1ccc(F)cc1C |
| InChI | InChI=1S/C10H11FS2/c1-3-10(12)13-9-5-4-8(11)6-7(9)2/h4-6H,3H2,1-2H3 |
| InChIKey | OIGGUFQSTJBVMY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-fluoro-2-methylphenyl) propanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluoro-2-methylphenyl) propanedithioate?
The IUPAC name of (4-fluoro-2-methylphenyl) propanedithioate (CID 129075399) is (4-fluoro-2-methylphenyl) propanedithioate.
What is the SMILES notation for (4-fluoro-2-methylphenyl) propanedithioate?
The canonical SMILES for (4-fluoro-2-methylphenyl) propanedithioate is CCC(=S)Sc1ccc(F)cc1C.
What is the InChIKey of (4-fluoro-2-methylphenyl) propanedithioate?
The InChIKey is OIGGUFQSTJBVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FS2/c1-3-10(12)13-9-5-4-8(11)6-7(9)2/h4-6H,3H2,1-2H3.
What are the key properties of (4-fluoro-2-methylphenyl) propanedithioate?
(4-fluoro-2-methylphenyl) propanedithioate has a molecular weight of 214.33 g/mol, XLogP of 3.96, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluoro-2-methylphenyl) propanedithioate is sourced from PubChem (CID 129075399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).