C18H15BrN4O2S — CID 129075440
4-[2-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-4-methylimidazo[4,5-c]pyridin-1-yl]butanenitrile (PubChem CID 129075440) has the molecular formula C18H15BrN4O2S and a molecular weight of 431.32 g/mol. Its IUPAC name is 4-[2-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-4-methylimidazo[4,5-c]pyridin-1-yl]butanenitrile.
| Compound Name | 4-[2-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-4-methylimidazo[4,5-c]pyridin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 129075440 |
| Molecular Formula | C18H15BrN4O2S |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 4-[2-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-4-methylimidazo[4,5-c]pyridin-1-yl]butanenitrile |
| SMILES | Cc1nccc2c1nc(Sc1cc3c(cc1Br)OCO3)n2CCCC#N |
| InChI | InChI=1S/C18H15BrN4O2S/c1-11-17-13(4-6-21-11)23(7-3-2-5-20)18(22-17)26-16-9-15-14(8-12(16)19)24-10-25-15/h4,6,8-9H,2-3,7,10H2,1H3 |
| InChIKey | QJFYOBUQQUMGLE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|