C56H40N2O — CID 129075806
10-[3-[7-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenyl]phenanthro[9,10-b]pyrazine (PubChem CID 129075806) has the molecular formula C56H40N2O and a molecular weight of 756.95 g/mol. Its IUPAC name is 10-[3-[7-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenyl]phenanthro[9,10-b]pyrazine.
| Compound Name | 10-[3-[7-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenyl]phenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 129075806 |
| Molecular Formula | C56H40N2O |
| Molecular Weight | 756.95 g/mol |
| Exact Mass | 756.31 |
| IUPAC Name | 10-[3-[7-[4-[3-ethenyl-2-[(Z)-prop-1-enyl]-1-benzofuran-7-yl]phenyl]-9,9-dimethylfluoren-2-yl]phenyl]phenanthro[9,10-b]pyrazine |
| SMILES | C=Cc1c(/C=C\C)oc2c(-c3ccc(-c4ccc5c(c4)C(C)(C)c4cc(-c6cccc(-c7ccc8c(c7)c7ccccc7c7nccnc87)c6)ccc4-5)cc3)cccc12 |
| InChI | InChI=1S/C56H40N2O/c1-5-11-52-41(6-2)48-17-10-16-42(55(48)59-52)35-20-18-34(19-21-35)39-22-25-44-45-26-23-40(33-51(45)56(3,4)50(44)32-39)37-13-9-12-36(30-37)38-24-27-47-49(31-38)43-14-7-8-15-46(43)53-54(47)58-29-28-57-53/h5-33H,2H2,1,3-4H3/b11-5- |
| InChIKey | CTELMTSWARDLPB-WZUFQYTHSA-N |
| XLogP | 15.33 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.95 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|