(3,6-dichloroquinolin-2-yl) hydrogen carbonate

C10H5Cl2NO3 — CID 129078802

IUPAC(3,6-dichloroquinolin-2-yl) hydrogen carbonate
SMILESO=C(O)Oc1nc2ccc(Cl)cc2cc1Cl
InChIInChI=1S/C10H5Cl2NO3/c11-6-1-2-8-5(3-6)4-7(12)9(13-8)16-10(14)15/h1-4H,(H,14,15)
InChIKeyRQRBMDCPXBYTMM-UHFFFAOYSA-N
MW258.06 g/mol
LogP3.60
Rot. Bonds1

About (3,6-dichloroquinolin-2-yl) hydrogen carbonate

(3,6-dichloroquinolin-2-yl) hydrogen carbonate (PubChem CID 129078802) has the molecular formula C10H5Cl2NO3 and a molecular weight of 258.06 g/mol. Its IUPAC name is (3,6-dichloroquinolin-2-yl) hydrogen carbonate.

Molecular Properties

Compound Name(3,6-dichloroquinolin-2-yl) hydrogen carbonate
PubChem CID129078802
Molecular FormulaC10H5Cl2NO3
Molecular Weight258.06 g/mol
Exact Mass256.96
IUPAC Name(3,6-dichloroquinolin-2-yl) hydrogen carbonate
SMILESO=C(O)Oc1nc2ccc(Cl)cc2cc1Cl
InChIInChI=1S/C10H5Cl2NO3/c11-6-1-2-8-5(3-6)4-7(12)9(13-8)16-10(14)15/h1-4H,(H,14,15)
InChIKeyRQRBMDCPXBYTMM-UHFFFAOYSA-N
XLogP3.60
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.06
LogP ≤ 53.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3,6-dichloroquinolin-2-yl) hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,6-dichloroquinolin-2-yl) hydrogen carbonate?
The IUPAC name of (3,6-dichloroquinolin-2-yl) hydrogen carbonate (CID 129078802) is (3,6-dichloroquinolin-2-yl) hydrogen carbonate.
What is the SMILES notation for (3,6-dichloroquinolin-2-yl) hydrogen carbonate?
The canonical SMILES for (3,6-dichloroquinolin-2-yl) hydrogen carbonate is O=C(O)Oc1nc2ccc(Cl)cc2cc1Cl.
What is the InChIKey of (3,6-dichloroquinolin-2-yl) hydrogen carbonate?
The InChIKey is RQRBMDCPXBYTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl2NO3/c11-6-1-2-8-5(3-6)4-7(12)9(13-8)16-10(14)15/h1-4H,(H,14,15).
What are the key properties of (3,6-dichloroquinolin-2-yl) hydrogen carbonate?
(3,6-dichloroquinolin-2-yl) hydrogen carbonate has a molecular weight of 258.06 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,6-dichloroquinolin-2-yl) hydrogen carbonate is sourced from PubChem (CID 129078802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).