About methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate
methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate (PubChem CID 129080054) has the molecular formula C15H13Cl2NO3
and a molecular weight of 326.18 g/mol. Its IUPAC name is methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate |
| PubChem CID | 129080054 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Cc2c(Cl)cccc2Cl)c(=O)[nH]c1C |
| InChI | InChI=1S/C15H13Cl2NO3/c1-8-10(15(20)21-2)6-9(14(19)18-8)7-11-12(16)4-3-5-13(11)17/h3-6H,7H2,1-2H3,(H,18,19) |
| InChIKey | CDHDSXWFYOSQQU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate?
The IUPAC name of methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate (CID 129080054) is methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate?
The canonical SMILES for methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate is COC(=O)c1cc(Cc2c(Cl)cccc2Cl)c(=O)[nH]c1C.
What is the InChIKey of methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate?
The InChIKey is CDHDSXWFYOSQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO3/c1-8-10(15(20)21-2)6-9(14(19)18-8)7-11-12(16)4-3-5-13(11)17/h3-6H,7H2,1-2H3,(H,18,19).
What are the key properties of methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate?
methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate has a molecular weight of 326.18 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,6-dichlorophenyl)methyl]-2-methyl-6-oxo-1H-pyridine-3-carboxylate is sourced from PubChem (CID 129080054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).