C21H23F3N4O4S — CID 129081199
[(6S,7R)-5-acetyl-6-cyclopropyl-7-methyl-8-[(6-methyl-2-pyridinyl)amino]-7,8-dihydro-6H-1,5-naphthyridin-2-yl] trifluoromethanesulfonate (PubChem CID 129081199) has the molecular formula C21H23F3N4O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is [(6S,7R)-5-acetyl-6-cyclopropyl-7-methyl-8-[(6-methyl-2-pyridinyl)amino]-7,8-dihydro-6H-1,5-naphthyridin-2-yl] trifluoromethanesulfonate.
| Compound Name | [(6S,7R)-5-acetyl-6-cyclopropyl-7-methyl-8-[(6-methyl-2-pyridinyl)amino]-7,8-dihydro-6H-1,5-naphthyridin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 129081199 |
| Molecular Formula | C21H23F3N4O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [(6S,7R)-5-acetyl-6-cyclopropyl-7-methyl-8-[(6-methyl-2-pyridinyl)amino]-7,8-dihydro-6H-1,5-naphthyridin-2-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)N1c2ccc(OS(=O)(=O)C(F)(F)F)nc2C(Nc2cccc(C)n2)[C@@H](C)[C@@H]1C1CC1 |
| InChI | InChI=1S/C21H23F3N4O4S/c1-11-5-4-6-16(25-11)26-18-12(2)20(14-7-8-14)28(13(3)29)15-9-10-17(27-19(15)18)32-33(30,31)21(22,23)24/h4-6,9-10,12,14,18,20H,7-8H2,1-3H3,(H,25,26)/t12-,18?,20-/m1/s1 |
| InChIKey | NPZKUFMBJHAOAU-SWGXAVNJSA-N |
| XLogP | 3.95 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|