C26H32N4O — CID 129081580
1-[(2S,3R)-2,3-dimethyl-4-[4-(methyliminomethyl)anilino]-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 129081580) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[(2S,3R)-2,3-dimethyl-4-[4-(methyliminomethyl)anilino]-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S,3R)-2,3-dimethyl-4-[4-(methyliminomethyl)anilino]-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 129081580 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 1-[(2S,3R)-2,3-dimethyl-4-[4-(methyliminomethyl)anilino]-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | C/N=C/c1ccc(NC2c3cc(C4=CCNCC4)ccc3N(C(C)=O)[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C26H32N4O/c1-17-18(2)30(19(3)31)25-10-7-22(21-11-13-28-14-12-21)15-24(25)26(17)29-23-8-5-20(6-9-23)16-27-4/h5-11,15-18,26,28-29H,12-14H2,1-4H3/b27-16+/t17-,18-,26?/m0/s1 |
| InChIKey | LGVYAQVSGJKYHL-LWJWHVDOSA-N |
| XLogP | 4.66 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|