C25H28N6O — CID 129081623
5-[[(2S,3R)-1-acetyl-2-cyclopropyl-3-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrazine-2-carbonitrile (PubChem CID 129081623) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 5-[[(2S,3R)-1-acetyl-2-cyclopropyl-3-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[(2S,3R)-1-acetyl-2-cyclopropyl-3-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 129081623 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 5-[[(2S,3R)-1-acetyl-2-cyclopropyl-3-methyl-6-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-2H-quinolin-4-yl]amino]pyrazine-2-carbonitrile |
| SMILES | CC(=O)N1c2ccc(C3=CCNCC3)cc2C(Nc2cnc(C#N)cn2)[C@@H](C)[C@@H]1C1CC1 |
| InChI | InChI=1S/C25H28N6O/c1-15-24(30-23-14-28-20(12-26)13-29-23)21-11-19(17-7-9-27-10-8-17)5-6-22(21)31(16(2)32)25(15)18-3-4-18/h5-7,11,13-15,18,24-25,27H,3-4,8-10H2,1-2H3,(H,29,30)/t15-,24?,25-/m1/s1 |
| InChIKey | PDULSDLJVJHHPB-ZZDPBKGBSA-N |
| XLogP | 3.66 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |