C24H28N2O3 — CID 129082789
(7R)-7-formyl-N-hydroxy-7-[2-[methyl-[(E)-3-phenylprop-2-enyl]amino]ethyl]-6,8-dihydro-5H-naphthalene-2-carboxamide (PubChem CID 129082789) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (7R)-7-formyl-N-hydroxy-7-[2-[methyl-[(E)-3-phenylprop-2-enyl]amino]ethyl]-6,8-dihydro-5H-naphthalene-2-carboxamide.
| Compound Name | (7R)-7-formyl-N-hydroxy-7-[2-[methyl-[(E)-3-phenylprop-2-enyl]amino]ethyl]-6,8-dihydro-5H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 129082789 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (7R)-7-formyl-N-hydroxy-7-[2-[methyl-[(E)-3-phenylprop-2-enyl]amino]ethyl]-6,8-dihydro-5H-naphthalene-2-carboxamide |
| SMILES | CN(C/C=C/c1ccccc1)CC[C@@]1(C=O)CCc2ccc(C(=O)NO)cc2C1 |
| InChI | InChI=1S/C24H28N2O3/c1-26(14-5-8-19-6-3-2-4-7-19)15-13-24(18-27)12-11-20-9-10-21(23(28)25-29)16-22(20)17-24/h2-10,16,18,29H,11-15,17H2,1H3,(H,25,28)/b8-5+/t24-/m0/s1 |
| InChIKey | XRFQZYDDFFJVNL-LNJOJYBOSA-N |
| XLogP | 3.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|