C27H38O5 — CID 129082802
methyl (E,4R)-4-[(3S,10S,13S)-3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate (PubChem CID 129082802) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl (E,4R)-4-[(3S,10S,13S)-3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate.
| Compound Name | methyl (E,4R)-4-[(3S,10S,13S)-3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
|---|---|
| PubChem CID | 129082802 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | methyl (E,4R)-4-[(3S,10S,13S)-3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthren-17-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](C)C1=CCC2C3CCC4C[C@@H](OC(C)=O)CC[C@]4(C)C3C(=O)C[C@]12C |
| InChI | InChI=1S/C27H38O5/c1-16(6-11-24(30)31-5)21-9-10-22-20-8-7-18-14-19(32-17(2)28)12-13-26(18,3)25(20)23(29)15-27(21,22)4/h6,9,11,16,18-20,22,25H,7-8,10,12-15H2,1-5H3/b11-6+/t16-,18?,19+,20?,22?,25?,26+,27-/m1/s1 |
| InChIKey | WDJPYKRVPSQQPC-JSHKLCQRSA-N |
| XLogP | 5.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|