About 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran
2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran (PubChem CID 129082860) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran |
| PubChem CID | 129082860 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran |
| SMILES | CCCCSC1OC=CC1C(C)C |
| InChI | InChI=1S/C11H20OS/c1-4-5-8-13-11-10(9(2)3)6-7-12-11/h6-7,9-11H,4-5,8H2,1-3H3 |
| InChIKey | FTNFEIGKIOKRAW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran?
The IUPAC name of 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran (CID 129082860) is 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran.
What is the SMILES notation for 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran?
The canonical SMILES for 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran is CCCCSC1OC=CC1C(C)C.
What is the InChIKey of 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran?
The InChIKey is FTNFEIGKIOKRAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OS/c1-4-5-8-13-11-10(9(2)3)6-7-12-11/h6-7,9-11H,4-5,8H2,1-3H3.
What are the key properties of 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran?
2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran has a molecular weight of 200.35 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-3-propan-2-yl-2,3-dihydrofuran is sourced from PubChem (CID 129082860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).