C25H34O6 — CID 129082876
[(2R,6R,10S,11R,13R,14R,15S)-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-(2-oxopropyl)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate (PubChem CID 129082876) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is [(2R,6R,10S,11R,13R,14R,15S)-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-(2-oxopropyl)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate.
| Compound Name | [(2R,6R,10S,11R,13R,14R,15S)-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-(2-oxopropyl)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
|---|---|
| PubChem CID | 129082876 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [(2R,6R,10S,11R,13R,14R,15S)-6-hydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-(2-oxopropyl)-14-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
| SMILES | CC(=O)C[C@@]12[C@H](OC(C)=O)C(C)C3[C@@H](C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@@H]34)[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H34O6/c1-12-7-18-19-14(3)22(31-15(4)28)24(9-13(2)27)20(23(24,5)6)17(19)8-16(11-26)10-25(18,30)21(12)29/h7-8,14,17-20,22,26,30H,9-11H2,1-6H3/t14?,17-,18+,19?,20-,22-,24+,25-/m1/s1 |
| InChIKey | CSCUWWKBLBLMDH-FZWSDCOESA-N |
| XLogP | 2.62 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|