About (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one
(4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 129083221) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one |
| PubChem CID | 129083221 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC1(C)C(=O)C2OC2[C@@H]1O |
| InChI | InChI=1S/C7H10O3/c1-7(2)5(8)3-4(10-3)6(7)9/h3-5,8H,1-2H3/t3?,4?,5-/m0/s1 |
| InChIKey | BOLGMCAXGFPYKK-YCXLAJEKSA-N |
| XLogP | -0.28 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one?
The IUPAC name of (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one (CID 129083221) is (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one.
What is the SMILES notation for (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one?
The canonical SMILES for (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one is CC1(C)C(=O)C2OC2[C@@H]1O.
What is the InChIKey of (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one?
The InChIKey is BOLGMCAXGFPYKK-YCXLAJEKSA-N. The full InChI is InChI=1S/C7H10O3/c1-7(2)5(8)3-4(10-3)6(7)9/h3-5,8H,1-2H3/t3?,4?,5-/m0/s1.
What are the key properties of (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one?
(4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one has a molecular weight of 142.15 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-3,3-dimethyl-6-oxabicyclo[3.1.0]hexan-2-one is sourced from PubChem (CID 129083221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).