About trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde
trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde (PubChem CID 129083366) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde.
Molecular Properties
| Compound Name | trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde |
| PubChem CID | 129083366 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde |
| SMILES | C=C(C)[C@H]1CC(C=O)C(C)[C@@H](O)C1 |
| InChI | InChI=1S/C11H18O2/c1-7(2)9-4-10(6-12)8(3)11(13)5-9/h6,8-11,13H,1,4-5H2,2-3H3/t8?,9-,10?,11-/m0/s1 |
| InChIKey | IAUVENJCDNIIBO-YIYTYNFBSA-N |
| XLogP | 1.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde?
The IUPAC name of trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde (CID 129083366) is trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde.
What is the SMILES notation for trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde?
The canonical SMILES for trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde is C=C(C)[C@H]1CC(C=O)C(C)[C@@H](O)C1.
What is the InChIKey of trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde?
The InChIKey is IAUVENJCDNIIBO-YIYTYNFBSA-N. The full InChI is InChI=1S/C11H18O2/c1-7(2)9-4-10(6-12)8(3)11(13)5-9/h6,8-11,13H,1,4-5H2,2-3H3/t8?,9-,10?,11-/m0/s1.
What are the key properties of trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde?
trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde has a molecular weight of 182.26 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,5S)-3-hydroxy-2-methyl-5-prop-1-en-2-ylcyclohexane-1-carbaldehyde is sourced from PubChem (CID 129083366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).