About 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one
5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one (PubChem CID 129083427) has the molecular formula C12H19ClO
and a molecular weight of 214.74 g/mol. Its IUPAC name is 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one |
| PubChem CID | 129083427 |
| Molecular Formula | C12H19ClO |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=CCC(CCCCl)C(C)(C)C1=O |
| InChI | InChI=1S/C12H19ClO/c1-9-6-7-10(5-4-8-13)12(2,3)11(9)14/h6,10H,4-5,7-8H2,1-3H3 |
| InChIKey | IGLHCZLVBIHJDN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one?
The IUPAC name of 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one (CID 129083427) is 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one?
The canonical SMILES for 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one is CC1=CCC(CCCCl)C(C)(C)C1=O.
What is the InChIKey of 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one?
The InChIKey is IGLHCZLVBIHJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClO/c1-9-6-7-10(5-4-8-13)12(2,3)11(9)14/h6,10H,4-5,7-8H2,1-3H3.
What are the key properties of 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one?
5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one has a molecular weight of 214.74 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chloropropyl)-2,6,6-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 129083427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).