About (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal
(2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal (PubChem CID 129083665) has the molecular formula C15H17NOS
and a molecular weight of 259.37 g/mol. Its IUPAC name is (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal.
Molecular Properties
| Compound Name | (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal |
| PubChem CID | 129083665 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal |
| SMILES | C=CC(/C=C\C=O)=C/N(C)c1ccc(SC)cc1 |
| InChI | InChI=1S/C15H17NOS/c1-4-13(6-5-11-17)12-16(2)14-7-9-15(18-3)10-8-14/h4-12H,1H2,2-3H3/b6-5-,13-12- |
| InChIKey | ZPLNEBRUEQOZQV-JKHKTYJBSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal?
The IUPAC name of (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal (CID 129083665) is (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal.
What is the SMILES notation for (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal?
The canonical SMILES for (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal is C=CC(/C=C\C=O)=C/N(C)c1ccc(SC)cc1.
What is the InChIKey of (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal?
The InChIKey is ZPLNEBRUEQOZQV-JKHKTYJBSA-N. The full InChI is InChI=1S/C15H17NOS/c1-4-13(6-5-11-17)12-16(2)14-7-9-15(18-3)10-8-14/h4-12H,1H2,2-3H3/b6-5-,13-12-.
What are the key properties of (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal?
(2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal has a molecular weight of 259.37 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-4-[(N-methyl-4-methylsulfanylanilino)methylidene]hexa-2,5-dienal is sourced from PubChem (CID 129083665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).