C57H37N3O — CID 129084864
4-(4'-naphthalen-1-yl-2'-phenylspiro[fluorene-9,9'-indeno[2,1-d]pyrimidine]-2-yl)-N,N-diphenylbenzeneamine oxide (PubChem CID 129084864) has the molecular formula C57H37N3O and a molecular weight of 779.94 g/mol. Its IUPAC name is 4-(4'-naphthalen-1-yl-2'-phenylspiro[fluorene-9,9'-indeno[2,1-d]pyrimidine]-2-yl)-N,N-diphenylbenzeneamine oxide.
| Compound Name | 4-(4'-naphthalen-1-yl-2'-phenylspiro[fluorene-9,9'-indeno[2,1-d]pyrimidine]-2-yl)-N,N-diphenylbenzeneamine oxide |
|---|---|
| PubChem CID | 129084864 |
| Molecular Formula | C57H37N3O |
| Molecular Weight | 779.94 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | 4-(4'-naphthalen-1-yl-2'-phenylspiro[fluorene-9,9'-indeno[2,1-d]pyrimidine]-2-yl)-N,N-diphenylbenzeneamine oxide |
| SMILES | [O-][N+](c1ccccc1)(c1ccccc1)c1ccc(-c2ccc3c(c2)C2(c4ccccc4-3)c3ccccc3-c3c(-c4cccc5ccccc45)nc(-c4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C57H37N3O/c61-60(42-21-6-2-7-22-42,43-23-8-3-9-24-43)44-34-31-38(32-35-44)41-33-36-47-46-26-12-14-29-50(46)57(52(47)37-41)51-30-15-13-27-49(51)53-54(48-28-16-20-39-17-10-11-25-45(39)48)58-56(59-55(53)57)40-18-4-1-5-19-40/h1-37H |
| InChIKey | AYLYVBHKBRXBEK-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 48.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.94 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|