C13H12N2O4S — CID 129085024
(E)-4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)but-2-enoic acid (PubChem CID 129085024) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is (E)-4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)but-2-enoic acid.
| Compound Name | (E)-4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 129085024 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (E)-4-(4-benzyl-3,5-dioxo-1,2,4-thiadiazolidin-2-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/Cn1sc(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C13H12N2O4S/c16-11(17)7-4-8-15-12(18)14(13(19)20-15)9-10-5-2-1-3-6-10/h1-7H,8-9H2,(H,16,17)/b7-4+ |
| InChIKey | MRHZAWJPWVKDFV-QPJJXVBHSA-N |
| XLogP | 0.76 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|