C21H34O4 — CID 129085476
[2,6-bis(2-methoxypropan-2-yl)-4-methylphenyl] 2,2-dimethylbutanoate (PubChem CID 129085476) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is [2,6-bis(2-methoxypropan-2-yl)-4-methylphenyl] 2,2-dimethylbutanoate.
| Compound Name | [2,6-bis(2-methoxypropan-2-yl)-4-methylphenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 129085476 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | [2,6-bis(2-methoxypropan-2-yl)-4-methylphenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1c(C(C)(C)OC)cc(C)cc1C(C)(C)OC |
| InChI | InChI=1S/C21H34O4/c1-11-19(3,4)18(22)25-17-15(20(5,6)23-9)12-14(2)13-16(17)21(7,8)24-10/h12-13H,11H2,1-10H3 |
| InChIKey | JTOUIOXNVUZQHV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|