C10H19NO2 — CID 129085494
(1R,2S,3R)-3-pyrrolidin-1-ylcyclohexane-1,2-diol (PubChem CID 129085494) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (1R,2S,3R)-3-pyrrolidin-1-ylcyclohexane-1,2-diol.
| Compound Name | (1R,2S,3R)-3-pyrrolidin-1-ylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 129085494 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (1R,2S,3R)-3-pyrrolidin-1-ylcyclohexane-1,2-diol |
| SMILES | O[C@@H]1[C@H](O)CCC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C10H19NO2/c12-9-5-3-4-8(10(9)13)11-6-1-2-7-11/h8-10,12-13H,1-7H2/t8-,9-,10+/m1/s1 |
| InChIKey | PMKBFKAZYBXRBE-BBBLOLIVSA-N |
| XLogP | 0.36 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |