C22H40O4 — CID 129086476
[(2R,4S,5R)-2-dodec-11-en-2-yloxy-4,5,6-trimethyloxan-3-yl] acetate (PubChem CID 129086476) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is [(2R,4S,5R)-2-dodec-11-en-2-yloxy-4,5,6-trimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5R)-2-dodec-11-en-2-yloxy-4,5,6-trimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 129086476 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | [(2R,4S,5R)-2-dodec-11-en-2-yloxy-4,5,6-trimethyloxan-3-yl] acetate |
| SMILES | C=CCCCCCCCCC(C)O[C@@H]1OC(C)[C@H](C)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C22H40O4/c1-7-8-9-10-11-12-13-14-15-16(2)24-22-21(26-20(6)23)18(4)17(3)19(5)25-22/h7,16-19,21-22H,1,8-15H2,2-6H3/t16?,17-,18+,19?,21?,22-/m1/s1 |
| InChIKey | GCIBZKDMWHTAAR-FAXIPUKDSA-N |
| XLogP | 5.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|