C28H42N6O14 — CID 129086606
methyl 3-[3-(3-butoxy-3-oxopropyl)-5-[3-[2-[3-(3-hydroxypropyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate (PubChem CID 129086606) has the molecular formula C28H42N6O14 and a molecular weight of 686.67 g/mol. Its IUPAC name is methyl 3-[3-(3-butoxy-3-oxopropyl)-5-[3-[2-[3-(3-hydroxypropyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | methyl 3-[3-(3-butoxy-3-oxopropyl)-5-[3-[2-[3-(3-hydroxypropyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 129086606 |
| Molecular Formula | C28H42N6O14 |
| Molecular Weight | 686.67 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | methyl 3-[3-(3-butoxy-3-oxopropyl)-5-[3-[2-[3-(3-hydroxypropyl)-5-(2-methoxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
| SMILES | CCCCOC(=O)CCn1c(=O)n(CCC(=O)OC)c(=O)n(CCC(=O)OCCn2c(=O)n(CCCO)c(=O)n(CCOC)c2=O)c1=O |
| InChI | InChI=1S/C28H42N6O14/c1-4-5-17-47-21(37)8-12-31-25(41)30(11-7-20(36)46-3)26(42)32(27(31)43)13-9-22(38)48-19-15-34-24(40)29(10-6-16-35)23(39)33(28(34)44)14-18-45-2/h35H,4-19H2,1-3H3 |
| InChIKey | DXOPUGPCGLFXHG-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 240.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.67 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|