About thiophene-3,4-dithiol
thiophene-3,4-dithiol (PubChem CID 12908697) has the molecular formula C4H4S3
and a molecular weight of 148.28 g/mol. Its IUPAC name is thiophene-3,4-dithiol.
Molecular Properties
| Compound Name | thiophene-3,4-dithiol |
| PubChem CID | 12908697 |
| Molecular Formula | C4H4S3 |
| Molecular Weight | 148.28 g/mol |
| Exact Mass | 147.95 |
| IUPAC Name | thiophene-3,4-dithiol |
| SMILES | Sc1cscc1S |
| InChI | InChI=1S/C4H4S3/c5-3-1-7-2-4(3)6/h1-2,5-6H |
| InChIKey | TWXMZYPORGXIFB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze thiophene-3,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-3,4-dithiol?
The IUPAC name of thiophene-3,4-dithiol (CID 12908697) is thiophene-3,4-dithiol.
What is the SMILES notation for thiophene-3,4-dithiol?
The canonical SMILES for thiophene-3,4-dithiol is Sc1cscc1S.
What is the InChIKey of thiophene-3,4-dithiol?
The InChIKey is TWXMZYPORGXIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4S3/c5-3-1-7-2-4(3)6/h1-2,5-6H.
What are the key properties of thiophene-3,4-dithiol?
thiophene-3,4-dithiol has a molecular weight of 148.28 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-3,4-dithiol is sourced from PubChem (CID 12908697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).