About 6-(18F)fluoro-3-methyl-1,2-benzoxazole
6-(18F)fluoro-3-methyl-1,2-benzoxazole (PubChem CID 129087270) has the molecular formula C8H6FNO
and a molecular weight of 150.14 g/mol. Its IUPAC name is 6-(18F)fluoro-3-methyl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6-(18F)fluoro-3-methyl-1,2-benzoxazole |
| PubChem CID | 129087270 |
| Molecular Formula | C8H6FNO |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 6-(18F)fluoro-3-methyl-1,2-benzoxazole |
| SMILES | Cc1noc2cc([18F])ccc12 |
| InChI | InChI=1S/C8H6FNO/c1-5-7-3-2-6(9)4-8(7)11-10-5/h2-4H,1H3/i9-1 |
| InChIKey | AZTCUAJRDGGWPK-RVRFMXCPSA-N |
| XLogP | 2.28 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(18F)fluoro-3-methyl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(18F)fluoro-3-methyl-1,2-benzoxazole?
The IUPAC name of 6-(18F)fluoro-3-methyl-1,2-benzoxazole (CID 129087270) is 6-(18F)fluoro-3-methyl-1,2-benzoxazole.
What is the SMILES notation for 6-(18F)fluoro-3-methyl-1,2-benzoxazole?
The canonical SMILES for 6-(18F)fluoro-3-methyl-1,2-benzoxazole is Cc1noc2cc([18F])ccc12.
What is the InChIKey of 6-(18F)fluoro-3-methyl-1,2-benzoxazole?
The InChIKey is AZTCUAJRDGGWPK-RVRFMXCPSA-N. The full InChI is InChI=1S/C8H6FNO/c1-5-7-3-2-6(9)4-8(7)11-10-5/h2-4H,1H3/i9-1.
What are the key properties of 6-(18F)fluoro-3-methyl-1,2-benzoxazole?
6-(18F)fluoro-3-methyl-1,2-benzoxazole has a molecular weight of 150.14 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(18F)fluoro-3-methyl-1,2-benzoxazole is sourced from PubChem (CID 129087270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).