C23H16Cl2N2O2 — CID 129087342
(1S,5S,6S)-3-(3,5-dichlorophenyl)-1-methyl-6-phenyl-6-pyridin-4-yl-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 129087342) has the molecular formula C23H16Cl2N2O2 and a molecular weight of 423.30 g/mol. Its IUPAC name is (1S,5S,6S)-3-(3,5-dichlorophenyl)-1-methyl-6-phenyl-6-pyridin-4-yl-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | (1S,5S,6S)-3-(3,5-dichlorophenyl)-1-methyl-6-phenyl-6-pyridin-4-yl-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 129087342 |
| Molecular Formula | C23H16Cl2N2O2 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | (1S,5S,6S)-3-(3,5-dichlorophenyl)-1-methyl-6-phenyl-6-pyridin-4-yl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | C[C@]12C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@H]1[C@]2(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C23H16Cl2N2O2/c1-22-19(20(28)27(21(22)29)18-12-16(24)11-17(25)13-18)23(22,14-5-3-2-4-6-14)15-7-9-26-10-8-15/h2-13,19H,1H3/t19-,22-,23+/m1/s1 |
| InChIKey | SHSYCBXSKIZORZ-PTUXOGIPSA-N |
| XLogP | 4.88 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|