C42H42N12 — CID 129087583
4,5,10,11,16,17-hexakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene (PubChem CID 129087583) has the molecular formula C42H42N12 and a molecular weight of 714.88 g/mol. Its IUPAC name is 4,5,10,11,16,17-hexakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene.
| Compound Name | 4,5,10,11,16,17-hexakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene |
|---|---|
| PubChem CID | 129087583 |
| Molecular Formula | C42H42N12 |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.37 |
| IUPAC Name | 4,5,10,11,16,17-hexakis(1-methylpyrrol-2-yl)-3,6,9,12,15,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2,6,8,12,14-hexaene |
| SMILES | Cn1cccc1C1N=c2c3c(c4c(c2=NC1c1cccn1C)=NC(c1cccn1C)C(c1cccn1C)N=4)=NC(c1cccn1C)C(c1cccn1C)N=3 |
| InChI | InChI=1S/C42H42N12/c1-49-19-7-13-25(49)31-32(26-14-8-20-50(26)2)44-38-37(43-31)39-41(47-34(28-16-10-22-52(28)4)33(45-39)27-15-9-21-51(27)3)42-40(38)46-35(29-17-11-23-53(29)5)36(48-42)30-18-12-24-54(30)6/h7-24,31-36H,1-6H3 |
| InChIKey | WTMDGBCNWITBRL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|