C30H21F3N6 — CID 129087613
4,9-bis(4-methylphenyl)-14-[4-(trifluoromethyl)phenyl]-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene (PubChem CID 129087613) has the molecular formula C30H21F3N6 and a molecular weight of 522.53 g/mol. Its IUPAC name is 4,9-bis(4-methylphenyl)-14-[4-(trifluoromethyl)phenyl]-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene.
| Compound Name | 4,9-bis(4-methylphenyl)-14-[4-(trifluoromethyl)phenyl]-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 129087613 |
| Molecular Formula | C30H21F3N6 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 4,9-bis(4-methylphenyl)-14-[4-(trifluoromethyl)phenyl]-1,5,6,10,11,15-hexazatetracyclo[10.3.0.02,6.07,11]pentadeca-2,4,7,9,12,14-hexaene |
| SMILES | Cc1ccc(-c2cc3n(n2)c2cc(-c4ccc(C)cc4)nn2c2cc(-c4ccc(C(F)(F)F)cc4)nn32)cc1 |
| InChI | InChI=1S/C30H21F3N6/c1-18-3-7-20(8-4-18)24-15-27-37-28(16-25(34-37)21-9-5-19(2)6-10-21)39-29(38(27)35-24)17-26(36-39)22-11-13-23(14-12-22)30(31,32)33/h3-17H,1-2H3 |
| InChIKey | FQOXBOAJUSDDAN-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 51.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |