C15H18F6O7 — CID 129087827
9-(1-hydroperoxy-2,2-dimethylbutyl)-4,4-bis(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 129087827) has the molecular formula C15H18F6O7 and a molecular weight of 424.29 g/mol. Its IUPAC name is 9-(1-hydroperoxy-2,2-dimethylbutyl)-4,4-bis(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | 9-(1-hydroperoxy-2,2-dimethylbutyl)-4,4-bis(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 129087827 |
| Molecular Formula | C15H18F6O7 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 9-(1-hydroperoxy-2,2-dimethylbutyl)-4,4-bis(trifluoromethyl)-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CCC(C)(C)C(OO)C1C(=O)OC2C3OC(C(F)(F)F)(C(F)(F)F)OC3OC21 |
| InChI | InChI=1S/C15H18F6O7/c1-4-12(2,3)9(28-23)5-6-7(24-10(5)22)8-11(25-6)27-13(26-8,14(16,17)18)15(19,20)21/h5-9,11,23H,4H2,1-3H3 |
| InChIKey | SBTWCKDRCZSWBH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|