C17H27F7O4 — CID 129087834
1,1,1-trifluoro-2-[3-(2-fluoro-1-hydroperoxy-2-methylbutyl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol (PubChem CID 129087834) has the molecular formula C17H27F7O4 and a molecular weight of 428.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-(2-fluoro-1-hydroperoxy-2-methylbutyl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[3-(2-fluoro-1-hydroperoxy-2-methylbutyl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 129087834 |
| Molecular Formula | C17H27F7O4 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-(2-fluoro-1-hydroperoxy-2-methylbutyl)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-ol |
| SMILES | CCC(C)(F)C(OO)C1CC(C(C)(O)C(F)(F)F)CC(C(C)(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H27F7O4/c1-5-13(2,18)12(28-27)9-6-10(14(3,25)16(19,20)21)8-11(7-9)15(4,26)17(22,23)24/h9-12,25-27H,5-8H2,1-4H3 |
| InChIKey | IFIRHLKFPQXHRM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|