C18H22FNO4 — CID 129088003
7-[[(2S,4R,5S)-6-ethyl-5-fluoro-2-methoxy-4-methyloxan-3-yl]amino]chromen-2-one (PubChem CID 129088003) has the molecular formula C18H22FNO4 and a molecular weight of 335.38 g/mol. Its IUPAC name is 7-[[(2S,4R,5S)-6-ethyl-5-fluoro-2-methoxy-4-methyloxan-3-yl]amino]chromen-2-one.
| Compound Name | 7-[[(2S,4R,5S)-6-ethyl-5-fluoro-2-methoxy-4-methyloxan-3-yl]amino]chromen-2-one |
|---|---|
| PubChem CID | 129088003 |
| Molecular Formula | C18H22FNO4 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 7-[[(2S,4R,5S)-6-ethyl-5-fluoro-2-methoxy-4-methyloxan-3-yl]amino]chromen-2-one |
| SMILES | CCC1O[C@H](OC)C(Nc2ccc3ccc(=O)oc3c2)[C@@H](C)[C@@H]1F |
| InChI | InChI=1S/C18H22FNO4/c1-4-13-16(19)10(2)17(18(22-3)24-13)20-12-7-5-11-6-8-15(21)23-14(11)9-12/h5-10,13,16-18,20H,4H2,1-3H3/t10-,13?,16-,17?,18-/m0/s1 |
| InChIKey | FLARDTHVNSAASH-ZCCVHCOPSA-N |
| XLogP | 3.33 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|