About [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane
[4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane (PubChem CID 129088137) has the molecular formula C21H23P3
and a molecular weight of 368.34 g/mol. Its IUPAC name is [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane.
Molecular Properties
| Compound Name | [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane |
| PubChem CID | 129088137 |
| Molecular Formula | C21H23P3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane |
| SMILES | Cc1cc(P)ccc1-c1cccc(-c2cc(CP)cc(CP)c2)c1 |
| InChI | InChI=1S/C21H23P3/c1-14-7-20(24)5-6-21(14)18-4-2-3-17(11-18)19-9-15(12-22)8-16(10-19)13-23/h2-11H,12-13,22-24H2,1H3 |
| InChIKey | VYFZQEADEDLMBI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane?
The IUPAC name of [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane (CID 129088137) is [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane.
What is the SMILES notation for [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane?
The canonical SMILES for [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane is Cc1cc(P)ccc1-c1cccc(-c2cc(CP)cc(CP)c2)c1.
What is the InChIKey of [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane?
The InChIKey is VYFZQEADEDLMBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23P3/c1-14-7-20(24)5-6-21(14)18-4-2-3-17(11-18)19-9-15(12-22)8-16(10-19)13-23/h2-11H,12-13,22-24H2,1H3.
What are the key properties of [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane?
[4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane has a molecular weight of 368.34 g/mol, XLogP of 5.58, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-[3,5-bis(phosphanylmethyl)phenyl]phenyl]-3-methylphenyl]phosphane is sourced from PubChem (CID 129088137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).