About N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine
N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine (PubChem CID 129088411) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine.
Analyze N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine?
The IUPAC name of N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine (CID 129088411) is N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine.
What is the SMILES notation for N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine?
The canonical SMILES for N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine is C=C(CCC)N(C)CCN(C)C.
What is the InChIKey of N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine?
The InChIKey is CIEWJGLXDDHMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-6-7-10(2)12(5)9-8-11(3)4/h2,6-9H2,1,3-5H3.
What are the key properties of N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine?
N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,N'-trimethyl-N'-pent-1-en-2-ylethane-1,2-diamine is sourced from PubChem (CID 129088411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).