C24H16F3N5O4S — CID 129088712
3-methyl-9-(6-methylsulfonyl-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 129088712) has the molecular formula C24H16F3N5O4S and a molecular weight of 527.48 g/mol. Its IUPAC name is 3-methyl-9-(6-methylsulfonyl-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 3-methyl-9-(6-methylsulfonyl-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 129088712 |
| Molecular Formula | C24H16F3N5O4S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | 3-methyl-9-(6-methylsulfonyl-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Cn1c(=O)c2cnc3ccc(-c4ccc(S(C)(=O)=O)nc4)nc3c2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C24H16F3N5O4S/c1-31-22(33)16-12-28-18-8-7-17(13-6-9-19(29-11-13)37(2,35)36)30-20(18)21(16)32(23(31)34)15-5-3-4-14(10-15)24(25,26)27/h3-12H,1-2H3 |
| InChIKey | BELRGMVELBEXCY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 116.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|