C15H27N3O5 — CID 129088789
3-(5-tert-butyl-1,2-oxazol-3-yl)-1-(1-ethoxy-2,2-dimethoxyethyl)-1-methylurea (PubChem CID 129088789) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-(1-ethoxy-2,2-dimethoxyethyl)-1-methylurea.
| Compound Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-(1-ethoxy-2,2-dimethoxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 129088789 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 3-(5-tert-butyl-1,2-oxazol-3-yl)-1-(1-ethoxy-2,2-dimethoxyethyl)-1-methylurea |
| SMILES | CCOC(C(OC)OC)N(C)C(=O)Nc1cc(C(C)(C)C)on1 |
| InChI | InChI=1S/C15H27N3O5/c1-8-22-12(13(20-6)21-7)18(5)14(19)16-11-9-10(23-17-11)15(2,3)4/h9,12-13H,8H2,1-7H3,(H,16,17,19) |
| InChIKey | BRFIIVJVUGLTKN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|