C10H10O5 — CID 129088840
1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione (PubChem CID 129088840) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione.
| Compound Name | 1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
|---|---|
| PubChem CID | 129088840 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 1,6-dimethyl-4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8-trione |
| SMILES | CC12COC(=O)C1C1(C)C(=O)OC(=O)C21 |
| InChI | InChI=1S/C10H10O5/c1-9-3-14-6(11)4(9)10(2)5(9)7(12)15-8(10)13/h4-5H,3H2,1-2H3 |
| InChIKey | KXRIGJPVUMNYKV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|