C28H35F3O8S — CID 129089177
3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid (PubChem CID 129089177) has the molecular formula C28H35F3O8S and a molecular weight of 588.64 g/mol. Its IUPAC name is 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid.
| Compound Name | 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 129089177 |
| Molecular Formula | C28H35F3O8S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3-(1-adamantylmethoxycarbonyl)-5-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]oxycarbonylbenzenesulfonic acid |
| SMILES | CC(O)(C1CCC(OC(=O)c2cc(C(=O)OCC34CC5CC(CC(C5)C3)C4)cc(S(=O)(=O)O)c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C28H35F3O8S/c1-26(34,28(29,30)31)21-2-4-22(5-3-21)39-25(33)20-9-19(10-23(11-20)40(35,36)37)24(32)38-15-27-12-16-6-17(13-27)8-18(7-16)14-27/h9-11,16-18,21-22,34H,2-8,12-15H2,1H3,(H,35,36,37) |
| InChIKey | RTKAHCOXPRQWOI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|