C28H23FN8O2 — CID 129089226
1-[3-(fluoromethyl)-4-piperazin-1-ylphenyl]-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 129089226) has the molecular formula C28H23FN8O2 and a molecular weight of 522.54 g/mol. Its IUPAC name is 1-[3-(fluoromethyl)-4-piperazin-1-ylphenyl]-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[3-(fluoromethyl)-4-piperazin-1-ylphenyl]-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 129089226 |
| Molecular Formula | C28H23FN8O2 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[3-(fluoromethyl)-4-piperazin-1-ylphenyl]-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(N3CCNCC3)c(CF)c2)c2c1cnc1ccc(-c3cnc4[nH]ccc4c3)nc12 |
| InChI | InChI=1S/C28H23FN8O2/c29-13-17-12-19(1-4-23(17)36-9-7-30-8-10-36)37-25-20(27(38)35-28(37)39)15-32-22-3-2-21(34-24(22)25)18-11-16-5-6-31-26(16)33-14-18/h1-6,11-12,14-15,30H,7-10,13H2,(H,31,33)(H,35,38,39) |
| InChIKey | YKKBKLKQCKZOHY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|