About 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile
2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile (PubChem CID 129089439) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile |
| PubChem CID | 129089439 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile |
| SMILES | CCC1=CC=C(CC#N)CC1 |
| InChI | InChI=1S/C10H13N/c1-2-9-3-5-10(6-4-9)7-8-11/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | DPXCXRMCBKDWOK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile?
The IUPAC name of 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile (CID 129089439) is 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile.
What is the SMILES notation for 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile?
The canonical SMILES for 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile is CCC1=CC=C(CC#N)CC1.
What is the InChIKey of 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile?
The InChIKey is DPXCXRMCBKDWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-2-9-3-5-10(6-4-9)7-8-11/h3,5H,2,4,6-7H2,1H3.
What are the key properties of 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile?
2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile has a molecular weight of 147.22 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylcyclohexa-1,3-dien-1-yl)acetonitrile is sourced from PubChem (CID 129089439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).