C19H22N4 — CID 129089444
4-N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]-4-N-(4-aminophenyl)benzene-1,4-diamine (PubChem CID 129089444) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]-4-N-(4-aminophenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]-4-N-(4-aminophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 129089444 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]-4-N-(4-aminophenyl)benzene-1,4-diamine |
| SMILES | C=C/C(=C\C=C(/C)N)N(c1ccc(N)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H22N4/c1-3-17(9-4-14(2)20)23(18-10-5-15(21)6-11-18)19-12-7-16(22)8-13-19/h3-13H,1,20-22H2,2H3/b14-4+,17-9+ |
| InChIKey | OGLQWXSSHXFZRQ-YVOKAPOOSA-N |
| XLogP | 3.92 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|