About 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide
2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide (PubChem CID 129089521) has the molecular formula C13H17F3N2
and a molecular weight of 258.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide |
| PubChem CID | 129089521 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide |
| SMILES | Cc1ccccc1N(C)/C(=N/C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2/c1-9(2)17-12(13(14,15)16)18(4)11-8-6-5-7-10(11)3/h5-9H,1-4H3/b17-12+ |
| InChIKey | JFDIHNLGOKUGAA-SFQUDFHCSA-N |
| XLogP | 3.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide?
The IUPAC name of 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide (CID 129089521) is 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide.
What is the SMILES notation for 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide?
The canonical SMILES for 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide is Cc1ccccc1N(C)/C(=N/C(C)C)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide?
The InChIKey is JFDIHNLGOKUGAA-SFQUDFHCSA-N. The full InChI is InChI=1S/C13H17F3N2/c1-9(2)17-12(13(14,15)16)18(4)11-8-6-5-7-10(11)3/h5-9H,1-4H3/b17-12+.
What are the key properties of 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide?
2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide has a molecular weight of 258.29 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-methyl-N-(2-methylphenyl)-N'-propan-2-ylethanimidamide is sourced from PubChem (CID 129089521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).