C20H36FN5 — CID 129089556
(E)-3-N-[(Z)-1-[2-[amino(ethyl)amino]ethyl-methylamino]but-2-enyl]-2-(2-fluorocyclohexa-2,4-dien-1-yl)-1-N-methylbut-2-ene-1,3-diamine (PubChem CID 129089556) has the molecular formula C20H36FN5 and a molecular weight of 365.54 g/mol. Its IUPAC name is (E)-3-N-[(Z)-1-[2-[amino(ethyl)amino]ethyl-methylamino]but-2-enyl]-2-(2-fluorocyclohexa-2,4-dien-1-yl)-1-N-methylbut-2-ene-1,3-diamine.
| Compound Name | (E)-3-N-[(Z)-1-[2-[amino(ethyl)amino]ethyl-methylamino]but-2-enyl]-2-(2-fluorocyclohexa-2,4-dien-1-yl)-1-N-methylbut-2-ene-1,3-diamine |
|---|---|
| PubChem CID | 129089556 |
| Molecular Formula | C20H36FN5 |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | (E)-3-N-[(Z)-1-[2-[amino(ethyl)amino]ethyl-methylamino]but-2-enyl]-2-(2-fluorocyclohexa-2,4-dien-1-yl)-1-N-methylbut-2-ene-1,3-diamine |
| SMILES | C/C=C\C(N/C(C)=C(/CNC)C1CC=CC=C1F)N(C)CCN(N)CC |
| InChI | InChI=1S/C20H36FN5/c1-6-10-20(25(5)13-14-26(22)7-2)24-16(3)18(15-23-4)17-11-8-9-12-19(17)21/h6,8-10,12,17,20,23-24H,7,11,13-15,22H2,1-5H3/b10-6-,18-16- |
| InChIKey | BKJZXIPPTLTHBW-DGTVWQJTSA-N |
| XLogP | 2.53 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|